C10H12FNO6 — CID 143929192
fluoro 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetate (PubChem CID 143929192) has the molecular formula C10H12FNO6 and a molecular weight of 261.20 g/mol. Its IUPAC name is fluoro 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetate.
| Compound Name | fluoro 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 143929192 |
| Molecular Formula | C10H12FNO6 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | fluoro 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCCN1C(=O)C=CC1=O)OF |
| InChI | InChI=1S/C10H12FNO6/c11-18-10(15)7-17-6-5-16-4-3-12-8(13)1-2-9(12)14/h1-2H,3-7H2 |
| InChIKey | PKPJIHOOELCEGF-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|