C8H12ClN3O4 — CID 53250844
2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide;hydrochloride (PubChem CID 53250844) has the molecular formula C8H12ClN3O4 and a molecular weight of 249.65 g/mol. Its IUPAC name is 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 53250844 |
| Molecular Formula | C8H12ClN3O4 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-aminooxy-N-[2-(2,5-dioxopyrrol-1-yl)ethyl]acetamide;hydrochloride |
| SMILES | Cl.NOCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H11N3O4.ClH/c9-15-5-6(12)10-3-4-11-7(13)1-2-8(11)14;/h1-2H,3-5,9H2,(H,10,12);1H |
| InChIKey | BGCNYRPLYOBWJM-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|