C13H19N3O6 — CID 12626847
2-N,6-N,1-tris(2-hydroxyethyl)-4-oxopyridine-2,6-dicarboxamide (PubChem CID 12626847) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-N,6-N,1-tris(2-hydroxyethyl)-4-oxopyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N,1-tris(2-hydroxyethyl)-4-oxopyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 12626847 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-N,6-N,1-tris(2-hydroxyethyl)-4-oxopyridine-2,6-dicarboxamide |
| SMILES | O=C(NCCO)c1cc(=O)cc(C(=O)NCCO)n1CCO |
| InChI | InChI=1S/C13H19N3O6/c17-4-1-14-12(21)10-7-9(20)8-11(16(10)3-6-19)13(22)15-2-5-18/h7-8,17-19H,1-6H2,(H,14,21)(H,15,22) |
| InChIKey | VNGDVECECYKASR-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 140.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |