C10H14N2O4 — CID 139721487
N,1-bis(2-hydroxyethyl)-4-oxopyridine-2-carboxamide (PubChem CID 139721487) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N,1-bis(2-hydroxyethyl)-4-oxopyridine-2-carboxamide.
| Compound Name | N,1-bis(2-hydroxyethyl)-4-oxopyridine-2-carboxamide |
|---|---|
| PubChem CID | 139721487 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N,1-bis(2-hydroxyethyl)-4-oxopyridine-2-carboxamide |
| SMILES | O=C(NCCO)c1cc(=O)ccn1CCO |
| InChI | InChI=1S/C10H14N2O4/c13-5-2-11-10(16)9-7-8(15)1-3-12(9)4-6-14/h1,3,7,13-14H,2,4-6H2,(H,11,16) |
| InChIKey | PYVMKAYKBAHENY-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |