C24H32N2O4 — CID 54556478
2-[6-(1,3-dihydroxy-6-methyl-4,5-dihydroisoindol-2-yl)hexyl]-6-methyl-4,5-dihydroisoindole-1,3-diol (PubChem CID 54556478) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[6-(1,3-dihydroxy-6-methyl-4,5-dihydroisoindol-2-yl)hexyl]-6-methyl-4,5-dihydroisoindole-1,3-diol.
| Compound Name | 2-[6-(1,3-dihydroxy-6-methyl-4,5-dihydroisoindol-2-yl)hexyl]-6-methyl-4,5-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54556478 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-[6-(1,3-dihydroxy-6-methyl-4,5-dihydroisoindol-2-yl)hexyl]-6-methyl-4,5-dihydroisoindole-1,3-diol |
| SMILES | CC1=Cc2c(c(O)n(CCCCCCn3c(O)c4c(c3O)CCC(C)=C4)c2O)CC1 |
| InChI | InChI=1S/C24H32N2O4/c1-15-7-9-17-19(13-15)23(29)25(21(17)27)11-5-3-4-6-12-26-22(28)18-10-8-16(2)14-20(18)24(26)30/h13-14,27-30H,3-12H2,1-2H3 |
| InChIKey | ZNNAALIMIVBNJB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|