About 3-methoxybut-2-enoyl chloride
3-methoxybut-2-enoyl chloride (PubChem CID 54557484) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is 3-methoxybut-2-enoyl chloride.
Molecular Properties
| Compound Name | 3-methoxybut-2-enoyl chloride |
| PubChem CID | 54557484 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 3-methoxybut-2-enoyl chloride |
| SMILES | COC(C)=CC(=O)Cl |
| InChI | InChI=1S/C5H7ClO2/c1-4(8-2)3-5(6)7/h3H,1-2H3 |
| InChIKey | ZOEKCHLPVQJQQE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybut-2-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybut-2-enoyl chloride?
The IUPAC name of 3-methoxybut-2-enoyl chloride (CID 54557484) is 3-methoxybut-2-enoyl chloride.
What is the SMILES notation for 3-methoxybut-2-enoyl chloride?
The canonical SMILES for 3-methoxybut-2-enoyl chloride is COC(C)=CC(=O)Cl.
What is the InChIKey of 3-methoxybut-2-enoyl chloride?
The InChIKey is ZOEKCHLPVQJQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-4(8-2)3-5(6)7/h3H,1-2H3.
What are the key properties of 3-methoxybut-2-enoyl chloride?
3-methoxybut-2-enoyl chloride has a molecular weight of 134.56 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybut-2-enoyl chloride is sourced from PubChem (CID 54557484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).