About 1-iodo-2-methylundecane
1-iodo-2-methylundecane (PubChem CID 545590) has the molecular formula C12H25I
and a molecular weight of 296.24 g/mol. Its IUPAC name is 1-iodo-2-methylundecane.
Molecular Properties
| Compound Name | 1-iodo-2-methylundecane |
| PubChem CID | 545590 |
| Molecular Formula | C12H25I |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-iodo-2-methylundecane |
| SMILES | CCCCCCCCCC(C)CI |
| InChI | InChI=1S/C12H25I/c1-3-4-5-6-7-8-9-10-12(2)11-13/h12H,3-11H2,1-2H3 |
| InChIKey | RTWBFGUVCAVDFO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-methylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-methylundecane?
The IUPAC name of 1-iodo-2-methylundecane (CID 545590) is 1-iodo-2-methylundecane.
What is the SMILES notation for 1-iodo-2-methylundecane?
The canonical SMILES for 1-iodo-2-methylundecane is CCCCCCCCCC(C)CI.
What is the InChIKey of 1-iodo-2-methylundecane?
The InChIKey is RTWBFGUVCAVDFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25I/c1-3-4-5-6-7-8-9-10-12(2)11-13/h12H,3-11H2,1-2H3.
What are the key properties of 1-iodo-2-methylundecane?
1-iodo-2-methylundecane has a molecular weight of 296.24 g/mol, XLogP of 5.20, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-methylundecane is sourced from PubChem (CID 545590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).