About bis(2-methylpropyl) pentyl phosphate
bis(2-methylpropyl) pentyl phosphate (PubChem CID 54560421) has the molecular formula C13H29O4P
and a molecular weight of 280.34 g/mol. Its IUPAC name is bis(2-methylpropyl) pentyl phosphate.
Molecular Properties
| Compound Name | bis(2-methylpropyl) pentyl phosphate |
| PubChem CID | 54560421 |
| Molecular Formula | C13H29O4P |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | bis(2-methylpropyl) pentyl phosphate |
| SMILES | CCCCCOP(=O)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C13H29O4P/c1-6-7-8-9-15-18(14,16-10-12(2)3)17-11-13(4)5/h12-13H,6-11H2,1-5H3 |
| InChIKey | ZQDRPUXYWNCXLZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl) pentyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl) pentyl phosphate?
The IUPAC name of bis(2-methylpropyl) pentyl phosphate (CID 54560421) is bis(2-methylpropyl) pentyl phosphate.
What is the SMILES notation for bis(2-methylpropyl) pentyl phosphate?
The canonical SMILES for bis(2-methylpropyl) pentyl phosphate is CCCCCOP(=O)(OCC(C)C)OCC(C)C.
What is the InChIKey of bis(2-methylpropyl) pentyl phosphate?
The InChIKey is ZQDRPUXYWNCXLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29O4P/c1-6-7-8-9-15-18(14,16-10-12(2)3)17-11-13(4)5/h12-13H,6-11H2,1-5H3.
What are the key properties of bis(2-methylpropyl) pentyl phosphate?
bis(2-methylpropyl) pentyl phosphate has a molecular weight of 280.34 g/mol, XLogP of 4.65, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) pentyl phosphate is sourced from PubChem (CID 54560421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).