C25H21F4N4O+ — CID 54561784
1-[2-[4-[3-(4-fluorophenyl)-5-(trifluoromethyl)indol-1-yl]pyridin-1-ium-1-yl]ethyl]imidazolidin-2-one (PubChem CID 54561784) has the molecular formula C25H21F4N4O+ and a molecular weight of 469.46 g/mol. Its IUPAC name is 1-[2-[4-[3-(4-fluorophenyl)-5-(trifluoromethyl)indol-1-yl]pyridin-1-ium-1-yl]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-[3-(4-fluorophenyl)-5-(trifluoromethyl)indol-1-yl]pyridin-1-ium-1-yl]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 54561784 |
| Molecular Formula | C25H21F4N4O+ |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 1-[2-[4-[3-(4-fluorophenyl)-5-(trifluoromethyl)indol-1-yl]pyridin-1-ium-1-yl]ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CC[n+]1ccc(-n2cc(-c3ccc(F)cc3)c3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C25H20F4N4O/c26-19-4-1-17(2-5-19)22-16-33(23-6-3-18(15-21(22)23)25(27,28)29)20-7-10-31(11-8-20)13-14-32-12-9-30-24(32)34/h1-8,10-11,15-16H,9,12-14H2/p+1 |
| InChIKey | ZRBFDEAKHLPORW-UHFFFAOYSA-O |
| XLogP | 4.77 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|