C11H13F2N3O — CID 28574585
1-[2-(2,5-difluoroanilino)ethyl]imidazolidin-2-one (PubChem CID 28574585) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is 1-[2-(2,5-difluoroanilino)ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-(2,5-difluoroanilino)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 28574585 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-[2-(2,5-difluoroanilino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNc1cc(F)ccc1F |
| InChI | InChI=1S/C11H13F2N3O/c12-8-1-2-9(13)10(7-8)14-3-5-16-6-4-15-11(16)17/h1-2,7,14H,3-6H2,(H,15,17) |
| InChIKey | ULRVHZCYAROQQR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |