C11H12F3N3O — CID 62809560
1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one (PubChem CID 62809560) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 62809560 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H12F3N3O/c12-7-5-8(13)10(14)9(6-7)15-1-3-17-4-2-16-11(17)18/h5-6,15H,1-4H2,(H,16,18) |
| InChIKey | QGZWJUGTYRSSHF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|