About 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one
1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one (PubChem CID 62809560) has the molecular formula C11H12F3N3O
and a molecular weight of 259.23 g/mol. Its IUPAC name is 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one |
| PubChem CID | 62809560 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H12F3N3O/c12-7-5-8(13)10(14)9(6-7)15-1-3-17-4-2-16-11(17)18/h5-6,15H,1-4H2,(H,16,18) |
| InChIKey | QGZWJUGTYRSSHF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one?
The IUPAC name of 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one (CID 62809560) is 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one is O=C1NCCN1CCNc1cc(F)cc(F)c1F.
What is the InChIKey of 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one?
The InChIKey is QGZWJUGTYRSSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N3O/c12-7-5-8(13)10(14)9(6-7)15-1-3-17-4-2-16-11(17)18/h5-6,15H,1-4H2,(H,16,18).
What are the key properties of 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one?
1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one has a molecular weight of 259.23 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,3,5-trifluoroanilino)ethyl]imidazolidin-2-one is sourced from PubChem (CID 62809560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).