C11H10F5N3O — CID 115564338
1-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]imidazolidin-2-one (PubChem CID 115564338) has the molecular formula C11H10F5N3O and a molecular weight of 295.21 g/mol. Its IUPAC name is 1-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 115564338 |
| Molecular Formula | C11H10F5N3O |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-[2-(2,3,4,5,6-pentafluoroanilino)ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5N3O/c12-5-6(13)8(15)10(9(16)7(5)14)17-1-3-19-4-2-18-11(19)20/h17H,1-4H2,(H,18,20) |
| InChIKey | ZFTWFUFXZXNCNC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|