C41H45N6O7P — CID 54563570
CID 54563570 (PubChem CID 54563570) has the molecular formula C41H45N6O7P and a molecular weight of 764.82 g/mol.
| Compound Name | CID 54563570 |
|---|---|
| PubChem CID | 54563570 |
| Molecular Formula | C41H45N6O7P |
| Molecular Weight | 764.82 g/mol |
| Exact Mass | 764.31 |
| IUPAC Name | — |
| SMILES | CC(C)CC(NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)O/[P+]([O-])=C/C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C41H45N6O7P/c1-28(2)20-38(54-55(52)26-37(48)43-23-29-12-5-3-6-13-29)47-40(50)36(22-33-24-42-27-44-33)45-39(49)35(46-41(51)53-25-30-14-7-4-8-15-30)21-32-18-11-17-31-16-9-10-19-34(31)32/h3-19,24,26-28,35-36,38H,20-23,25H2,1-2H3,(H,42,44)(H,43,48)(H,45,49)(H,46,51)(H,47,50)/t35-,36+,38?/m1/s1 |
| InChIKey | ZSGQYOFGQKVEEJ-BIQRBTPFSA-N |
| XLogP | 4.42 |
| TPSA | 186.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|