C12H11BrFNO2 — CID 54564651
1-(4-bromo-2-methylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol (PubChem CID 54564651) has the molecular formula C12H11BrFNO2 and a molecular weight of 300.13 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol.
| Compound Name | 1-(4-bromo-2-methylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54564651 |
| Molecular Formula | C12H11BrFNO2 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-3-(fluoromethyl)pyrrole-2,5-diol |
| SMILES | Cc1cc(Br)ccc1-n1c(O)cc(CF)c1O |
| InChI | InChI=1S/C12H11BrFNO2/c1-7-4-9(13)2-3-10(7)15-11(16)5-8(6-14)12(15)17/h2-5,16-17H,6H2,1H3 |
| InChIKey | ZSYQLQDXAOOTGG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |