C29H30O6 — CID 54565634
2-[[2,5-bis[[3-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane (PubChem CID 54565634) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-[[2,5-bis[[3-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,5-bis[[3-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 54565634 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[[2,5-bis[[3-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]methyl]oxirane |
| SMILES | c1cc(Cc2ccc(Cc3cccc(OCC4CO4)c3)c(OCC3CO3)c2)cc(OCC2CO2)c1 |
| InChI | InChI=1S/C29H30O6/c1-3-20(11-24(5-1)30-14-26-16-32-26)9-22-7-8-23(29(13-22)35-19-28-18-34-28)10-21-4-2-6-25(12-21)31-15-27-17-33-27/h1-8,11-13,26-28H,9-10,14-19H2 |
| InChIKey | ZTPOUNJKWUQOCA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|