C20H41N3O5 — CID 54566828
tert-butyl 2-hydroxy-2-[2-(methylideneamino)ethylamino]-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanoate;ethane (PubChem CID 54566828) has the molecular formula C20H41N3O5 and a molecular weight of 403.56 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-2-[2-(methylideneamino)ethylamino]-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanoate;ethane.
| Compound Name | tert-butyl 2-hydroxy-2-[2-(methylideneamino)ethylamino]-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanoate;ethane |
|---|---|
| PubChem CID | 54566828 |
| Molecular Formula | C20H41N3O5 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.30 |
| IUPAC Name | tert-butyl 2-hydroxy-2-[2-(methylideneamino)ethylamino]-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanoate;ethane |
| SMILES | C=NCCNC(O)(CCCNCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C18H35N3O5.C2H6/c1-16(2,3)25-14(22)13-20-10-8-9-18(24,21-12-11-19-7)15(23)26-17(4,5)6;1-2/h20-21,24H,7-13H2,1-6H3;1-2H3 |
| InChIKey | ZUKPVGOSZLUAIZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|