About 11H-pyrrolo[2,1-b][3]benzazepine
11H-pyrrolo[2,1-b][3]benzazepine (PubChem CID 54568229) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 11H-pyrrolo[2,1-b][3]benzazepine.
Molecular Properties
| Compound Name | 11H-pyrrolo[2,1-b][3]benzazepine |
| PubChem CID | 54568229 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 11H-pyrrolo[2,1-b][3]benzazepine |
| SMILES | C1=Cn2cccc2Cc2ccccc21 |
| InChI | InChI=1S/C13H11N/c1-2-5-12-10-13-6-3-8-14(13)9-7-11(12)4-1/h1-9H,10H2 |
| InChIKey | ZVJHKYFQORNKRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11H-pyrrolo[2,1-b][3]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-pyrrolo[2,1-b][3]benzazepine?
The IUPAC name of 11H-pyrrolo[2,1-b][3]benzazepine (CID 54568229) is 11H-pyrrolo[2,1-b][3]benzazepine.
What is the SMILES notation for 11H-pyrrolo[2,1-b][3]benzazepine?
The canonical SMILES for 11H-pyrrolo[2,1-b][3]benzazepine is C1=Cn2cccc2Cc2ccccc21.
What is the InChIKey of 11H-pyrrolo[2,1-b][3]benzazepine?
The InChIKey is ZVJHKYFQORNKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-5-12-10-13-6-3-8-14(13)9-7-11(12)4-1/h1-9H,10H2.
What are the key properties of 11H-pyrrolo[2,1-b][3]benzazepine?
11H-pyrrolo[2,1-b][3]benzazepine has a molecular weight of 181.24 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-pyrrolo[2,1-b][3]benzazepine is sourced from PubChem (CID 54568229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).