C8H10N2O2 — CID 54568642
2,5-bis(methylimino)cyclohexane-1,4-dione (PubChem CID 54568642) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,5-bis(methylimino)cyclohexane-1,4-dione.
| Compound Name | 2,5-bis(methylimino)cyclohexane-1,4-dione |
|---|---|
| PubChem CID | 54568642 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2,5-bis(methylimino)cyclohexane-1,4-dione |
| SMILES | C/N=C1\CC(=O)/C(=N/C)CC1=O |
| InChI | InChI=1S/C8H10N2O2/c1-9-5-3-8(12)6(10-2)4-7(5)11/h3-4H2,1-2H3/b9-5+,10-6+ |
| InChIKey | ZVQJWXYFHJWVJU-NXZHAISVSA-N |
| XLogP | 0.06 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|