C10H14N2O2 — CID 57299168
4,5-bis(ethylimino)cyclohexane-1,2-dione (PubChem CID 57299168) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4,5-bis(ethylimino)cyclohexane-1,2-dione.
| Compound Name | 4,5-bis(ethylimino)cyclohexane-1,2-dione |
|---|---|
| PubChem CID | 57299168 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4,5-bis(ethylimino)cyclohexane-1,2-dione |
| SMILES | CC/N=C1\CC(=O)C(=O)C\C1=N/CC |
| InChI | InChI=1S/C10H14N2O2/c1-3-11-7-5-9(13)10(14)6-8(7)12-4-2/h3-6H2,1-2H3/b11-7+,12-8+ |
| InChIKey | BRXWALYJOBDKNC-MKICQXMISA-N |
| XLogP | 0.84 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|