C22H27ClN2O3 — CID 54568952
[1-butyl-4-[4-chloro-2-methyl-3-(3-methylbut-2-en-2-yl)benzoyl]pyrazol-5-yl] acetate (PubChem CID 54568952) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is [1-butyl-4-[4-chloro-2-methyl-3-(3-methylbut-2-en-2-yl)benzoyl]pyrazol-5-yl] acetate.
| Compound Name | [1-butyl-4-[4-chloro-2-methyl-3-(3-methylbut-2-en-2-yl)benzoyl]pyrazol-5-yl] acetate |
|---|---|
| PubChem CID | 54568952 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [1-butyl-4-[4-chloro-2-methyl-3-(3-methylbut-2-en-2-yl)benzoyl]pyrazol-5-yl] acetate |
| SMILES | CCCCn1ncc(C(=O)c2ccc(Cl)c(C(C)=C(C)C)c2C)c1OC(C)=O |
| InChI | InChI=1S/C22H27ClN2O3/c1-7-8-11-25-22(28-16(6)26)18(12-24-25)21(27)17-9-10-19(23)20(15(17)5)14(4)13(2)3/h9-10,12H,7-8,11H2,1-6H3 |
| InChIKey | ZVWDFBSPCBKTMY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |