C24H34N2O6S2 — CID 54185626
[1-butyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propane-2-sulfonate (PubChem CID 54185626) has the molecular formula C24H34N2O6S2 and a molecular weight of 510.68 g/mol. Its IUPAC name is [1-butyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propane-2-sulfonate.
| Compound Name | [1-butyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propane-2-sulfonate |
|---|---|
| PubChem CID | 54185626 |
| Molecular Formula | C24H34N2O6S2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | [1-butyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] propane-2-sulfonate |
| SMILES | CCCCn1ncc(C(=O)c2ccc(S(C)(=O)=O)c(C(C)=C(C)C)c2C)c1OS(=O)(=O)C(C)C |
| InChI | InChI=1S/C24H34N2O6S2/c1-9-10-13-26-24(32-34(30,31)16(4)5)20(14-25-26)23(27)19-11-12-21(33(8,28)29)22(18(19)7)17(6)15(2)3/h11-12,14,16H,9-10,13H2,1-8H3 |
| InChIKey | PEWOAPWUOCOKAR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 112.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|