C19H24N2O6S2 — CID 54157216
[1-methyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] methanesulfonate (PubChem CID 54157216) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is [1-methyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] methanesulfonate.
| Compound Name | [1-methyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 54157216 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [1-methyl-4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-methylsulfonylbenzoyl]pyrazol-5-yl] methanesulfonate |
| SMILES | CC(C)=C(C)c1c(S(C)(=O)=O)ccc(C(=O)c2cnn(C)c2OS(C)(=O)=O)c1C |
| InChI | InChI=1S/C19H24N2O6S2/c1-11(2)12(3)17-13(4)14(8-9-16(17)28(6,23)24)18(22)15-10-20-21(5)19(15)27-29(7,25)26/h8-10H,1-7H3 |
| InChIKey | OLXLMDLMQRMMOI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 112.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|