2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid

C9H14O5 — CID 545703

IUPAC2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid
SMILESCC1(C(=O)O)OC(C(C)(C)C)OC1=O
InChIInChI=1S/C9H14O5/c1-8(2,3)7-13-6(12)9(4,14-7)5(10)11/h7H,1-4H3,(H,10,11)
InChIKeyDGIRJWSECFBJFP-UHFFFAOYSA-N
MW202.21 g/mol
LogP0.78
Rot. Bonds1

About 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid

2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid (PubChem CID 545703) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid.

Molecular Properties

Compound Name2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid
PubChem CID545703
Molecular FormulaC9H14O5
Molecular Weight202.21 g/mol
Exact Mass202.08
IUPAC Name2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid
SMILESCC1(C(=O)O)OC(C(C)(C)C)OC1=O
InChIInChI=1S/C9H14O5/c1-8(2,3)7-13-6(12)9(4,14-7)5(10)11/h7H,1-4H3,(H,10,11)
InChIKeyDGIRJWSECFBJFP-UHFFFAOYSA-N
XLogP0.78
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.21
LogP ≤ 50.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid (CID 545703) is 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid is CC1(C(=O)O)OC(C(C)(C)C)OC1=O.
What is the InChIKey of 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid?
The InChIKey is DGIRJWSECFBJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5/c1-8(2,3)7-13-6(12)9(4,14-7)5(10)11/h7H,1-4H3,(H,10,11).
What are the key properties of 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid?
2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid has a molecular weight of 202.21 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 545703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).