C9H14O5 — CID 545703
2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid (PubChem CID 545703) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 545703 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-tert-butyl-4-methyl-5-oxo-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C(=O)O)OC(C(C)(C)C)OC1=O |
| InChI | InChI=1S/C9H14O5/c1-8(2,3)7-13-6(12)9(4,14-7)5(10)11/h7H,1-4H3,(H,10,11) |
| InChIKey | DGIRJWSECFBJFP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|