About (4-iodo-2-octylphenyl) hydrogen carbonate
(4-iodo-2-octylphenyl) hydrogen carbonate (PubChem CID 54572223) has the molecular formula C15H21IO3
and a molecular weight of 376.23 g/mol. Its IUPAC name is (4-iodo-2-octylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-iodo-2-octylphenyl) hydrogen carbonate |
| PubChem CID | 54572223 |
| Molecular Formula | C15H21IO3 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (4-iodo-2-octylphenyl) hydrogen carbonate |
| SMILES | CCCCCCCCc1cc(I)ccc1OC(=O)O |
| InChI | InChI=1S/C15H21IO3/c1-2-3-4-5-6-7-8-12-11-13(16)9-10-14(12)19-15(17)18/h9-11H,2-8H2,1H3,(H,17,18) |
| InChIKey | ZYCUQJZEMAYGGG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-iodo-2-octylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodo-2-octylphenyl) hydrogen carbonate?
The IUPAC name of (4-iodo-2-octylphenyl) hydrogen carbonate (CID 54572223) is (4-iodo-2-octylphenyl) hydrogen carbonate.
What is the SMILES notation for (4-iodo-2-octylphenyl) hydrogen carbonate?
The canonical SMILES for (4-iodo-2-octylphenyl) hydrogen carbonate is CCCCCCCCc1cc(I)ccc1OC(=O)O.
What is the InChIKey of (4-iodo-2-octylphenyl) hydrogen carbonate?
The InChIKey is ZYCUQJZEMAYGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21IO3/c1-2-3-4-5-6-7-8-12-11-13(16)9-10-14(12)19-15(17)18/h9-11H,2-8H2,1H3,(H,17,18).
What are the key properties of (4-iodo-2-octylphenyl) hydrogen carbonate?
(4-iodo-2-octylphenyl) hydrogen carbonate has a molecular weight of 376.23 g/mol, XLogP of 5.25, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodo-2-octylphenyl) hydrogen carbonate is sourced from PubChem (CID 54572223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).