C37H42N6O11 — CID 54576605
methyl (2S,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxane-2-carboxylate (PubChem CID 54576605) has the molecular formula C37H42N6O11 and a molecular weight of 746.77 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 54576605 |
| Molecular Formula | C37H42N6O11 |
| Molecular Weight | 746.77 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | methyl (2S,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](OC[C@H]2O[C@H](OC)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H](N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C37H42N6O11/c1-23(44)52-31-28(40-42-38)29(41-43-39)36(54-33(31)35(45)46-2)51-22-27-30(48-19-24-13-7-4-8-14-24)32(49-20-25-15-9-5-10-16-25)34(37(47-3)53-27)50-21-26-17-11-6-12-18-26/h4-18,27-34,36-37H,19-22H2,1-3H3/t27-,28-,29+,30-,31+,32+,33+,34-,36-,37+/m1/s1 |
| InChIKey | NLRVSWASISGZLP-QTUQGPIQSA-N |
| XLogP | 5.32 |
| TPSA | 214.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|