C10H18O2 — CID 54577276
(4S,5S)-4-ethenyl-5-ethyl-2,2,4-trimethyl-1,3-dioxolane (PubChem CID 54577276) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (4S,5S)-4-ethenyl-5-ethyl-2,2,4-trimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-ethenyl-5-ethyl-2,2,4-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 54577276 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4S,5S)-4-ethenyl-5-ethyl-2,2,4-trimethyl-1,3-dioxolane |
| SMILES | C=C[C@]1(C)OC(C)(C)O[C@H]1CC |
| InChI | InChI=1S/C10H18O2/c1-6-8-10(5,7-2)12-9(3,4)11-8/h7-8H,2,6H2,1,3-5H3/t8-,10-/m0/s1 |
| InChIKey | MEIDKZALGDONKC-WPRPVWTQSA-N |
| XLogP | 2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|