C32H38N7O2 — CID 54578172
CID 54578172 (PubChem CID 54578172) has the molecular formula C32H38N7O2 and a molecular weight of 552.70 g/mol.
| Compound Name | CID 54578172 |
|---|---|
| PubChem CID | 54578172 |
| Molecular Formula | C32H38N7O2 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | — |
| SMILES | CCCCc1nc(C)n(CC2=CC(C)(C)N([O])C2(C)C)c(=O)c1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H38N7O2/c1-7-8-13-28-27(30(40)38(21(2)33-28)20-24-19-31(3,4)39(41)32(24,5)6)18-22-14-16-23(17-15-22)25-11-9-10-12-26(25)29-34-36-37-35-29/h9-12,14-17,19H,7-8,13,18,20H2,1-6H3,(H,34,35,36,37) |
| InChIKey | HMDWKVORUFFQGF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|