C24H25N3O2 — CID 54580227
[(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1,6-naphthyridin-2-yl)methanone (PubChem CID 54580227) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is [(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1,6-naphthyridin-2-yl)methanone.
| Compound Name | [(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1,6-naphthyridin-2-yl)methanone |
|---|---|
| PubChem CID | 54580227 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | [(4S,4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(1,6-naphthyridin-2-yl)methanone |
| SMILES | O=C(c1ccc2cnccc2n1)N1CC[C@@](O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H25N3O2/c28-23(21-11-10-17-16-25-14-12-20(17)26-21)27-15-13-24(29,18-6-2-1-3-7-18)19-8-4-5-9-22(19)27/h1-3,6-7,10-12,14,16,19,22,29H,4-5,8-9,13,15H2/t19-,22+,24-/m1/s1 |
| InChIKey | RWFPAKDCXZIENT-WNOPAQSVSA-N |
| XLogP | 3.92 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |