C13H12ClN9S — CID 54581395
1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea (PubChem CID 54581395) has the molecular formula C13H12ClN9S and a molecular weight of 361.82 g/mol. Its IUPAC name is 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea.
| Compound Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 54581395 |
| Molecular Formula | C13H12ClN9S |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea |
| SMILES | Nc1ncc(Cl)nc1CNC(=S)Nc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C13H12ClN9S/c14-11-6-16-12(15)10(20-11)5-17-13(24)19-8-1-3-9(4-2-8)23-7-18-21-22-23/h1-4,6-7H,5H2,(H2,15,16)(H2,17,19,24) |
| InChIKey | SQVKHWHCQUYWGV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|