C15H18N6S — CID 7042982
1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea (PubChem CID 7042982) has the molecular formula C15H18N6S and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea.
| Compound Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 7042982 |
| Molecular Formula | C15H18N6S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-[4-(tetrazol-1-yl)phenyl]thiourea |
| SMILES | S=C(Nc1ccc(-n2cnnn2)cc1)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H18N6S/c22-15(18-14-8-10-1-2-11(14)7-10)17-12-3-5-13(6-4-12)21-9-16-19-20-21/h3-6,9-11,14H,1-2,7-8H2,(H2,17,18,22)/t10-,11-,14-/m0/s1 |
| InChIKey | PNCVTZHJYLBCRJ-MJVIPROJSA-N |
| XLogP | 2.14 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|