C22H21NO2 — CID 54583098
3-[4-[(3-phenylphenyl)methylamino]phenyl]propanoic acid (PubChem CID 54583098) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[4-[(3-phenylphenyl)methylamino]phenyl]propanoic acid.
| Compound Name | 3-[4-[(3-phenylphenyl)methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54583098 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-[4-[(3-phenylphenyl)methylamino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NCc2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H21NO2/c24-22(25)14-11-17-9-12-21(13-10-17)23-16-18-5-4-8-20(15-18)19-6-2-1-3-7-19/h1-10,12-13,15,23H,11,14,16H2,(H,24,25) |
| InChIKey | QGGAXEHCBJKZTM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |