C24H16FN3O3 — CID 54583242
N-[(3-fluorophenyl)methyl]-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide (PubChem CID 54583242) has the molecular formula C24H16FN3O3 and a molecular weight of 413.41 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 54583242 |
| Molecular Formula | C24H16FN3O3 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2,3-bis(furan-2-yl)quinoxaline-6-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)c1ccc2nc(-c3ccco3)c(-c3ccco3)nc2c1 |
| InChI | InChI=1S/C24H16FN3O3/c25-17-5-1-4-15(12-17)14-26-24(29)16-8-9-18-19(13-16)28-23(21-7-3-11-31-21)22(27-18)20-6-2-10-30-20/h1-13H,14H2,(H,26,29) |
| InChIKey | PFBDMRFQRDXNNZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |