C21H19N3O4S — CID 54583412
(5S)-5-methyl-3-(4-methylsulfonylphenyl)-1-(quinolin-4-ylmethyl)imidazolidine-2,4-dione (PubChem CID 54583412) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is (5S)-5-methyl-3-(4-methylsulfonylphenyl)-1-(quinolin-4-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-3-(4-methylsulfonylphenyl)-1-(quinolin-4-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54583412 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (5S)-5-methyl-3-(4-methylsulfonylphenyl)-1-(quinolin-4-ylmethyl)imidazolidine-2,4-dione |
| SMILES | C[C@H]1C(=O)N(c2ccc(S(C)(=O)=O)cc2)C(=O)N1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C21H19N3O4S/c1-14-20(25)24(16-7-9-17(10-8-16)29(2,27)28)21(26)23(14)13-15-11-12-22-19-6-4-3-5-18(15)19/h3-12,14H,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | JWDCBJLGCVILNA-AWEZNQCLSA-N |
| XLogP | 3.00 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|