C19H18N4O7 — CID 54583670
N-(3-nitrophenyl)-2-oxo-5-(3,4,5-trimethoxyphenyl)-1,3-dihydroimidazole-4-carboxamide (PubChem CID 54583670) has the molecular formula C19H18N4O7 and a molecular weight of 414.37 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-oxo-5-(3,4,5-trimethoxyphenyl)-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N-(3-nitrophenyl)-2-oxo-5-(3,4,5-trimethoxyphenyl)-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 54583670 |
| Molecular Formula | C19H18N4O7 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(3-nitrophenyl)-2-oxo-5-(3,4,5-trimethoxyphenyl)-1,3-dihydroimidazole-4-carboxamide |
| SMILES | COc1cc(-c2[nH]c(=O)[nH]c2C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18N4O7/c1-28-13-7-10(8-14(29-2)17(13)30-3)15-16(22-19(25)21-15)18(24)20-11-5-4-6-12(9-11)23(26)27/h4-9H,1-3H3,(H,20,24)(H2,21,22,25) |
| InChIKey | QYKNFMJYNVMMQI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|