C24H18N4O3 — CID 54584103
[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(3-phenyl-1,2-oxazol-5-yl)methanone (PubChem CID 54584103) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(3-phenyl-1,2-oxazol-5-yl)methanone.
| Compound Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(3-phenyl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 54584103 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(3-phenyl-1,2-oxazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)no1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C24H18N4O3/c29-22-11-5-4-10-18(22)21-13-19(17-9-6-12-25-15-17)26-28(21)24(30)23-14-20(27-31-23)16-7-2-1-3-8-16/h1-12,14-15,21,29H,13H2 |
| InChIKey | QMIDUCZMFDIDEN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|