C25H20N4O4 — CID 24966066
[3-(2-Hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 24966066) has the molecular formula C25H20N4O4 and a molecular weight of 440.40 g/mol. Its IUPAC name is [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone.
| Compound Name | [3-(2-Hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 24966066 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-[5-(4-methoxyphenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NO2)C(=O)N3C(CC(=N3)C4=CN=CC=C4)C5=CC=CC=C5O |
| InChI | InChI=1S/C25H20N4O4/c1-32-18-10-8-16(9-11-18)24-14-21(28-33-24)25(31)29-22(19-6-2-3-7-23(19)30)13-20(27-29)17-5-4-12-26-15-17/h2-12,14-15,22,30H,13H2,1H3 |
| InChIKey | RLZYEROKZLONOK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | 711 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|