C17H22N2O5 — CID 54584212
(5R,6R,7S,8S)-5-(hydroxymethyl)-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol (PubChem CID 54584212) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is (5R,6R,7S,8S)-5-(hydroxymethyl)-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol.
| Compound Name | (5R,6R,7S,8S)-5-(hydroxymethyl)-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol |
|---|---|
| PubChem CID | 54584212 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (5R,6R,7S,8S)-5-(hydroxymethyl)-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol |
| SMILES | COc1ccc(CCc2cn3c(n2)[C@H](O)[C@@H](O)[C@H](O)[C@H]3CO)cc1 |
| InChI | InChI=1S/C17H22N2O5/c1-24-12-6-3-10(4-7-12)2-5-11-8-19-13(9-20)14(21)15(22)16(23)17(19)18-11/h3-4,6-8,13-16,20-23H,2,5,9H2,1H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | KPLBHAFSPRCBBS-LVQVYYBASA-N |
| XLogP | -0.02 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |