C18H24N2O5 — CID 74982386
5-(hydroxymethyl)-2-[3-(4-methoxyphenyl)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol (PubChem CID 74982386) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-[3-(4-methoxyphenyl)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol.
| Compound Name | 5-(hydroxymethyl)-2-[3-(4-methoxyphenyl)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol |
|---|---|
| PubChem CID | 74982386 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-(hydroxymethyl)-2-[3-(4-methoxyphenyl)propyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6,7,8-triol |
| SMILES | COc1ccc(CCCc2cn3c(n2)C(O)C(O)C(O)C3CO)cc1 |
| InChI | InChI=1S/C18H24N2O5/c1-25-13-7-5-11(6-8-13)3-2-4-12-9-20-14(10-21)15(22)16(23)17(24)18(20)19-12/h5-9,14-17,21-24H,2-4,10H2,1H3 |
| InChIKey | CEEPDUGFKXBMCP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |