C30H46O4 — CID 54584285
(Z,6R)-6-[(1S,4R,5R,8S,9S,12S,13R)-12-ethenyl-13-(3-methoxy-3-oxopropyl)-4,8-dimethyl-5-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]-2-methylhept-2-enoic acid (PubChem CID 54584285) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (Z,6R)-6-[(1S,4R,5R,8S,9S,12S,13R)-12-ethenyl-13-(3-methoxy-3-oxopropyl)-4,8-dimethyl-5-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]-2-methylhept-2-enoic acid.
| Compound Name | (Z,6R)-6-[(1S,4R,5R,8S,9S,12S,13R)-12-ethenyl-13-(3-methoxy-3-oxopropyl)-4,8-dimethyl-5-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 54584285 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (Z,6R)-6-[(1S,4R,5R,8S,9S,12S,13R)-12-ethenyl-13-(3-methoxy-3-oxopropyl)-4,8-dimethyl-5-tetracyclo[7.5.0.01,13.04,8]tetradecanyl]-2-methylhept-2-enoic acid |
| SMILES | C=C[C@@H]1CC[C@@H]2[C@]3(CC[C@]4(C)[C@@H]([C@H](C)CC/C=C(/C)C(=O)O)CC[C@@]24C)C[C@]13CCC(=O)OC |
| InChI | InChI=1S/C30H46O4/c1-7-22-11-12-24-28(5)15-13-23(20(2)9-8-10-21(3)26(32)33)27(28,4)17-18-30(24)19-29(22,30)16-14-25(31)34-6/h7,10,20,22-24H,1,8-9,11-19H2,2-6H3,(H,32,33)/b21-10-/t20-,22-,23-,24+,27-,28+,29-,30+/m1/s1 |
| InChIKey | JDMVZCVPHOWJJQ-RKLLWIJMSA-N |
| XLogP | 7.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|