C17H17FN2O4 — CID 54584799
ethyl 2-[[5-(4-fluoro-2-methoxyphenyl)-3-pyridinyl]methylamino]-2-oxoacetate (PubChem CID 54584799) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is ethyl 2-[[5-(4-fluoro-2-methoxyphenyl)-3-pyridinyl]methylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[[5-(4-fluoro-2-methoxyphenyl)-3-pyridinyl]methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 54584799 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | ethyl 2-[[5-(4-fluoro-2-methoxyphenyl)-3-pyridinyl]methylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCc1cncc(-c2ccc(F)cc2OC)c1 |
| InChI | InChI=1S/C17H17FN2O4/c1-3-24-17(22)16(21)20-9-11-6-12(10-19-8-11)14-5-4-13(18)7-15(14)23-2/h4-8,10H,3,9H2,1-2H3,(H,20,21) |
| InChIKey | UDQQZZDGPQKHNE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|