C21H23F3N2O3 — CID 71770953
4-pentyl-5-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]morpholin-3-one (PubChem CID 71770953) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-pentyl-5-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]morpholin-3-one.
| Compound Name | 4-pentyl-5-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]morpholin-3-one |
|---|---|
| PubChem CID | 71770953 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-pentyl-5-[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]morpholin-3-one |
| SMILES | CCCCCN1C(=O)COCC1c1cncc(-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H23F3N2O3/c1-2-3-4-9-26-19(13-28-14-20(26)27)17-10-16(11-25-12-17)15-5-7-18(8-6-15)29-21(22,23)24/h5-8,10-12,19H,2-4,9,13-14H2,1H3 |
| InChIKey | MWPVORRSNNZNTI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|