C27H23N5O2 — CID 54585426
2-[4-(4-methoxyquinolin-6-yl)-5-(6-methyl-2-pyridinyl)pyrazol-1-yl]-N-phenylacetamide (PubChem CID 54585426) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[4-(4-methoxyquinolin-6-yl)-5-(6-methyl-2-pyridinyl)pyrazol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-(4-methoxyquinolin-6-yl)-5-(6-methyl-2-pyridinyl)pyrazol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 54585426 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[4-(4-methoxyquinolin-6-yl)-5-(6-methyl-2-pyridinyl)pyrazol-1-yl]-N-phenylacetamide |
| SMILES | COc1ccnc2ccc(-c3cnn(CC(=O)Nc4ccccc4)c3-c3cccc(C)n3)cc12 |
| InChI | InChI=1S/C27H23N5O2/c1-18-7-6-10-24(30-18)27-22(19-11-12-23-21(15-19)25(34-2)13-14-28-23)16-29-32(27)17-26(33)31-20-8-4-3-5-9-20/h3-16H,17H2,1-2H3,(H,31,33) |
| InChIKey | IJIPBYSVWMXNOB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |