C22H21ClN2O2 — CID 54585690
(3E)-4-chloro-1-(cyclohexylmethyl)-3-(2-oxo-2-pyridin-3-ylethylidene)indol-2-one (PubChem CID 54585690) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is (3E)-4-chloro-1-(cyclohexylmethyl)-3-(2-oxo-2-pyridin-3-ylethylidene)indol-2-one.
| Compound Name | (3E)-4-chloro-1-(cyclohexylmethyl)-3-(2-oxo-2-pyridin-3-ylethylidene)indol-2-one |
|---|---|
| PubChem CID | 54585690 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (3E)-4-chloro-1-(cyclohexylmethyl)-3-(2-oxo-2-pyridin-3-ylethylidene)indol-2-one |
| SMILES | O=C(/C=C1/C(=O)N(CC2CCCCC2)c2cccc(Cl)c21)c1cccnc1 |
| InChI | InChI=1S/C22H21ClN2O2/c23-18-9-4-10-19-21(18)17(12-20(26)16-8-5-11-24-13-16)22(27)25(19)14-15-6-2-1-3-7-15/h4-5,8-13,15H,1-3,6-7,14H2/b17-12+ |
| InChIKey | SBQHLTPQAMDNGK-SFQUDFHCSA-N |
| XLogP | 4.93 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|