C23H24F3NO2 — CID 54587106
[(4R,4aS,8aS)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone (PubChem CID 54587106) has the molecular formula C23H24F3NO2 and a molecular weight of 403.44 g/mol. Its IUPAC name is [(4R,4aS,8aS)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone.
| Compound Name | [(4R,4aS,8aS)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54587106 |
| Molecular Formula | C23H24F3NO2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(4R,4aS,8aS)-4-hydroxy-4-[3-(trifluoromethyl)phenyl]-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC[C@](O)(c2cccc(C(F)(F)F)c2)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C23H24F3NO2/c24-23(25,26)18-10-6-9-17(15-18)22(29)13-14-27(20-12-5-4-11-19(20)22)21(28)16-7-2-1-3-8-16/h1-3,6-10,15,19-20,29H,4-5,11-14H2/t19-,20-,22-/m0/s1 |
| InChIKey | KZVPSNWFEGOKEX-ONTIZHBOSA-N |
| XLogP | 5.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |