About 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide
4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide (PubChem CID 54587645) has the molecular formula C12H13Br2NO3
and a molecular weight of 379.05 g/mol. Its IUPAC name is 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide.
Molecular Properties
| Compound Name | 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide |
| PubChem CID | 54587645 |
| Molecular Formula | C12H13Br2NO3 |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide |
| SMILES | Br.COc1cc2c(C)[nH]c(=O)c(Br)c2cc1OC |
| InChI | InChI=1S/C12H12BrNO3.BrH/c1-6-7-4-9(16-2)10(17-3)5-8(7)11(13)12(15)14-6;/h4-5H,1-3H3,(H,14,15);1H |
| InChIKey | PJOJJHBBOURKCD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide?
The IUPAC name of 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide (CID 54587645) is 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide.
What is the SMILES notation for 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide?
The canonical SMILES for 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide is Br.COc1cc2c(C)[nH]c(=O)c(Br)c2cc1OC.
What is the InChIKey of 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide?
The InChIKey is PJOJJHBBOURKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO3.BrH/c1-6-7-4-9(16-2)10(17-3)5-8(7)11(13)12(15)14-6;/h4-5H,1-3H3,(H,14,15);1H.
What are the key properties of 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide?
4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide has a molecular weight of 379.05 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one;hydrobromide is sourced from PubChem (CID 54587645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).