C22H28O7 — CID 5459072
[(4R,4aR,5R,8aR)-8a-acetyloxy-5-hydroxy-3,4a,5-trimethyl-9-oxo-4,6,7,8-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 5459072) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is [(4R,4aR,5R,8aR)-8a-acetyloxy-5-hydroxy-3,4a,5-trimethyl-9-oxo-4,6,7,8-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4R,4aR,5R,8aR)-8a-acetyloxy-5-hydroxy-3,4a,5-trimethyl-9-oxo-4,6,7,8-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 5459072 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(4R,4aR,5R,8aR)-8a-acetyloxy-5-hydroxy-3,4a,5-trimethyl-9-oxo-4,6,7,8-tetrahydrobenzo[f][1]benzofuran-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1c2c(C)coc2C(=O)[C@@]2(OC(C)=O)CCC[C@@](C)(O)[C@@]12C |
| InChI | InChI=1S/C22H28O7/c1-7-12(2)19(25)28-18-15-13(3)11-27-16(15)17(24)22(29-14(4)23)10-8-9-20(5,26)21(18,22)6/h7,11,18,26H,8-10H2,1-6H3/b12-7-/t18-,20-,21-,22+/m1/s1 |
| InChIKey | XJLPGDXSMONXCG-LQMMDOLBSA-N |
| XLogP | 3.58 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|