C6H8N2O2 — CID 54593471
5-(aminomethyl)furan-3-carboxamide (PubChem CID 54593471) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 5-(aminomethyl)furan-3-carboxamide.
| Compound Name | 5-(aminomethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 54593471 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 5-(aminomethyl)furan-3-carboxamide |
| SMILES | NCc1cc(C(N)=O)co1 |
| InChI | InChI=1S/C6H8N2O2/c7-2-5-1-4(3-10-5)6(8)9/h1,3H,2,7H2,(H2,8,9) |
| InChIKey | PNVIXYAZDXPLHP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |