C11H20Cl2N4O2 — CID 54593650
ethyl 5-amino-1-piperidin-4-ylpyrazole-4-carboxylate;dihydrochloride (PubChem CID 54593650) has the molecular formula C11H20Cl2N4O2 and a molecular weight of 311.21 g/mol. Its IUPAC name is ethyl 5-amino-1-piperidin-4-ylpyrazole-4-carboxylate;dihydrochloride.
| Compound Name | ethyl 5-amino-1-piperidin-4-ylpyrazole-4-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 54593650 |
| Molecular Formula | C11H20Cl2N4O2 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | ethyl 5-amino-1-piperidin-4-ylpyrazole-4-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1cnn(C2CCNCC2)c1N.Cl.Cl |
| InChI | InChI=1S/C11H18N4O2.2ClH/c1-2-17-11(16)9-7-14-15(10(9)12)8-3-5-13-6-4-8;;/h7-8,13H,2-6,12H2,1H3;2*1H |
| InChIKey | GGZYMBPRBIZDIL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |