C10H16ClN3O2 — CID 154866227
methyl 2-piperidin-4-ylpyrazole-3-carboxylate;hydrochloride (PubChem CID 154866227) has the molecular formula C10H16ClN3O2 and a molecular weight of 245.71 g/mol. Its IUPAC name is methyl 2-piperidin-4-ylpyrazole-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-piperidin-4-ylpyrazole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 154866227 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | methyl 2-piperidin-4-ylpyrazole-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccnn1C1CCNCC1.Cl |
| InChI | InChI=1S/C10H15N3O2.ClH/c1-15-10(14)9-4-7-12-13(9)8-2-5-11-6-3-8;/h4,7-8,11H,2-3,5-6H2,1H3;1H |
| InChIKey | HUIWHCHYVMBHKF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |