C11H12ClN3O4S — CID 54594602
1-butyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride (PubChem CID 54594602) has the molecular formula C11H12ClN3O4S and a molecular weight of 317.75 g/mol. Its IUPAC name is 1-butyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride.
| Compound Name | 1-butyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride |
|---|---|
| PubChem CID | 54594602 |
| Molecular Formula | C11H12ClN3O4S |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 1-butyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonyl chloride |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2cc(S(=O)(=O)Cl)cnc21 |
| InChI | InChI=1S/C11H12ClN3O4S/c1-2-3-4-15-9-8(10(16)14-11(15)17)5-7(6-13-9)20(12,18)19/h5-6H,2-4H2,1H3,(H,14,16,17) |
| InChIKey | UDQVJROIBDPSFX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |